C33H36N6O2 — CID 59348860
N,N-diethyl-4-[[4-[[4-[[4-(2-methoxyethoxy)phenyl]iminomethyl]phenyl]diazenyl]-3-methylphenyl]diazenyl]aniline (PubChem CID 59348860) has the molecular formula C33H36N6O2 and a molecular weight of 548.69 g/mol. Its IUPAC name is N,N-diethyl-4-[[4-[[4-[[4-(2-methoxyethoxy)phenyl]iminomethyl]phenyl]diazenyl]-3-methylphenyl]diazenyl]aniline.
| Compound Name | N,N-diethyl-4-[[4-[[4-[[4-(2-methoxyethoxy)phenyl]iminomethyl]phenyl]diazenyl]-3-methylphenyl]diazenyl]aniline |
|---|---|
| PubChem CID | 59348860 |
| Molecular Formula | C33H36N6O2 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | N,N-diethyl-4-[[4-[[4-[[4-(2-methoxyethoxy)phenyl]iminomethyl]phenyl]diazenyl]-3-methylphenyl]diazenyl]aniline |
| SMILES | CCN(CC)c1ccc(/N=N/c2ccc(/N=N/c3ccc(/C=N/c4ccc(OCCOC)cc4)cc3)c(C)c2)cc1 |
| InChI | InChI=1S/C33H36N6O2/c1-5-39(6-2)31-16-11-29(12-17-31)35-37-30-15-20-33(25(3)23-30)38-36-28-9-7-26(8-10-28)24-34-27-13-18-32(19-14-27)41-22-21-40-4/h7-20,23-24H,5-6,21-22H2,1-4H3/b34-24+,37-35+,38-36+ |
| InChIKey | PLBISHLAJUNTPJ-DQYPGTJMSA-N |
| XLogP | 9.45 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|