C20H15N5 — CID 786981
N-(3,5-diphenyl-1,2,4-triazol-4-yl)-1-pyridin-3-ylmethanimine (PubChem CID 786981) has the molecular formula C20H15N5 and a molecular weight of 325.38 g/mol. Its IUPAC name is N-(3,5-diphenyl-1,2,4-triazol-4-yl)-1-pyridin-3-ylmethanimine.
| Compound Name | N-(3,5-diphenyl-1,2,4-triazol-4-yl)-1-pyridin-3-ylmethanimine |
|---|---|
| PubChem CID | 786981 |
| Molecular Formula | C20H15N5 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | N-(3,5-diphenyl-1,2,4-triazol-4-yl)-1-pyridin-3-ylmethanimine |
| SMILES | C(=Nn1c(-c2ccccc2)nnc1-c1ccccc1)c1cccnc1 |
| InChI | InChI=1S/C20H15N5/c1-3-9-17(10-4-1)19-23-24-20(18-11-5-2-6-12-18)25(19)22-15-16-8-7-13-21-14-16/h1-15H |
| InChIKey | QQFYMRRCOJIRRF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|