C24H22N4O3 — CID 11647302
(E)-N-(3,5-diphenyl-1,2,4-triazol-4-yl)-1-(3,4,5-trimethoxyphenyl)methanimine (PubChem CID 11647302) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is (E)-N-(3,5-diphenyl-1,2,4-triazol-4-yl)-1-(3,4,5-trimethoxyphenyl)methanimine.
| Compound Name | (E)-N-(3,5-diphenyl-1,2,4-triazol-4-yl)-1-(3,4,5-trimethoxyphenyl)methanimine |
|---|---|
| PubChem CID | 11647302 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (E)-N-(3,5-diphenyl-1,2,4-triazol-4-yl)-1-(3,4,5-trimethoxyphenyl)methanimine |
| SMILES | COc1cc(/C=N/n2c(-c3ccccc3)nnc2-c2ccccc2)cc(OC)c1OC |
| InChI | InChI=1S/C24H22N4O3/c1-29-20-14-17(15-21(30-2)22(20)31-3)16-25-28-23(18-10-6-4-7-11-18)26-27-24(28)19-12-8-5-9-13-19/h4-16H,1-3H3/b25-16+ |
| InChIKey | GRINSRVCJCDWBT-PCLIKHOPSA-N |
| XLogP | 4.52 |
| TPSA | 70.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|