C21H23N3O4 — CID 1387491
2-propyl-3-[(3,4,5-trimethoxyphenyl)methylideneamino]quinazolin-4-one (PubChem CID 1387491) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 2-propyl-3-[(3,4,5-trimethoxyphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 2-propyl-3-[(3,4,5-trimethoxyphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 1387491 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 2-propyl-3-[(3,4,5-trimethoxyphenyl)methylideneamino]quinazolin-4-one |
| SMILES | CCCc1nc2ccccc2c(=O)n1N=Cc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H23N3O4/c1-5-8-19-23-16-10-7-6-9-15(16)21(25)24(19)22-13-14-11-17(26-2)20(28-4)18(12-14)27-3/h6-7,9-13H,5,8H2,1-4H3 |
| InChIKey | ZHPZLFCSPCOMAH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|