C18H16N4O3 — CID 5424130
3-[(Z)-(4-nitrophenyl)methylideneamino]-2-propylquinazolin-4-one (PubChem CID 5424130) has the molecular formula C18H16N4O3 and a molecular weight of 336.35 g/mol. Its IUPAC name is 3-[(Z)-(4-nitrophenyl)methylideneamino]-2-propylquinazolin-4-one.
| Compound Name | 3-[(Z)-(4-nitrophenyl)methylideneamino]-2-propylquinazolin-4-one |
|---|---|
| PubChem CID | 5424130 |
| Molecular Formula | C18H16N4O3 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | 3-[(Z)-(4-nitrophenyl)methylideneamino]-2-propylquinazolin-4-one |
| SMILES | CCCc1nc2ccccc2c(=O)n1/N=C\c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H16N4O3/c1-2-5-17-20-16-7-4-3-6-15(16)18(23)21(17)19-12-13-8-10-14(11-9-13)22(24)25/h3-4,6-12H,2,5H2,1H3/b19-12- |
| InChIKey | LOFOPCZAUATTCT-UNOMPAQXSA-N |
| XLogP | 3.14 |
| TPSA | 90.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|