C24H22N4O3 — CID 9398219
(Z)-1-(3,5-dimethoxy-4-phenylmethoxyphenyl)-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine (PubChem CID 9398219) has the molecular formula C24H22N4O3 and a molecular weight of 414.47 g/mol. Its IUPAC name is (Z)-1-(3,5-dimethoxy-4-phenylmethoxyphenyl)-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine.
| Compound Name | (Z)-1-(3,5-dimethoxy-4-phenylmethoxyphenyl)-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 9398219 |
| Molecular Formula | C24H22N4O3 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (Z)-1-(3,5-dimethoxy-4-phenylmethoxyphenyl)-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine |
| SMILES | COc1cc(/C=N\n2cnnc2-c2ccccc2)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C24H22N4O3/c1-29-21-13-19(14-22(30-2)23(21)31-16-18-9-5-3-6-10-18)15-26-28-17-25-27-24(28)20-11-7-4-8-12-20/h3-15,17H,16H2,1-2H3/b26-15- |
| InChIKey | WMQVUENRXMTHAR-YSMPRRRNSA-N |
| XLogP | 4.42 |
| TPSA | 70.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|