C17H14F2N4O2 — CID 9028029
(Z)-1-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine (PubChem CID 9028029) has the molecular formula C17H14F2N4O2 and a molecular weight of 344.32 g/mol. Its IUPAC name is (Z)-1-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine.
| Compound Name | (Z)-1-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 9028029 |
| Molecular Formula | C17H14F2N4O2 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | (Z)-1-[4-(difluoromethoxy)-3-methoxyphenyl]-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine |
| SMILES | COc1cc(/C=N\n2cnnc2-c2ccccc2)ccc1OC(F)F |
| InChI | InChI=1S/C17H14F2N4O2/c1-24-15-9-12(7-8-14(15)25-17(18)19)10-21-23-11-20-22-16(23)13-5-3-2-4-6-13/h2-11,17H,1H3/b21-10- |
| InChIKey | KRSBOBSFBYQXAL-FBHDLOMBSA-N |
| XLogP | 3.44 |
| TPSA | 61.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|