C15H10F2N4 — CID 9028340
(Z)-1-(3,4-difluorophenyl)-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine (PubChem CID 9028340) has the molecular formula C15H10F2N4 and a molecular weight of 284.27 g/mol. Its IUPAC name is (Z)-1-(3,4-difluorophenyl)-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine.
| Compound Name | (Z)-1-(3,4-difluorophenyl)-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 9028340 |
| Molecular Formula | C15H10F2N4 |
| Molecular Weight | 284.27 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | (Z)-1-(3,4-difluorophenyl)-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine |
| SMILES | Fc1ccc(/C=N\n2cnnc2-c2ccccc2)cc1F |
| InChI | InChI=1S/C15H10F2N4/c16-13-7-6-11(8-14(13)17)9-19-21-10-18-20-15(21)12-4-2-1-3-5-12/h1-10H/b19-9- |
| InChIKey | VRBMBYZVYDLNMG-OCKHKDLRSA-N |
| XLogP | 3.11 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.27 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|