C19H20N4O2 — CID 9028321
(Z)-1-(4-methoxy-3-propoxyphenyl)-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine (PubChem CID 9028321) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is (Z)-1-(4-methoxy-3-propoxyphenyl)-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine.
| Compound Name | (Z)-1-(4-methoxy-3-propoxyphenyl)-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 9028321 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | (Z)-1-(4-methoxy-3-propoxyphenyl)-N-(3-phenyl-1,2,4-triazol-4-yl)methanimine |
| SMILES | CCCOc1cc(/C=N\n2cnnc2-c2ccccc2)ccc1OC |
| InChI | InChI=1S/C19H20N4O2/c1-3-11-25-18-12-15(9-10-17(18)24-2)13-21-23-14-20-22-19(23)16-7-5-4-6-8-16/h4-10,12-14H,3,11H2,1-2H3/b21-13- |
| InChIKey | HXOCEEIQHVZILJ-BKUYFWCQSA-N |
| XLogP | 3.62 |
| TPSA | 61.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|