C19H24N6O2 — CID 9244953
(Z)-N-[3-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-4-yl]-1-(3-ethoxy-4-propoxyphenyl)methanimine (PubChem CID 9244953) has the molecular formula C19H24N6O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is (Z)-N-[3-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-4-yl]-1-(3-ethoxy-4-propoxyphenyl)methanimine.
| Compound Name | (Z)-N-[3-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-4-yl]-1-(3-ethoxy-4-propoxyphenyl)methanimine |
|---|---|
| PubChem CID | 9244953 |
| Molecular Formula | C19H24N6O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | (Z)-N-[3-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-4-yl]-1-(3-ethoxy-4-propoxyphenyl)methanimine |
| SMILES | CCCOc1ccc(/C=N\n2cnnc2-n2nc(C)cc2C)cc1OCC |
| InChI | InChI=1S/C19H24N6O2/c1-5-9-27-17-8-7-16(11-18(17)26-6-2)12-21-24-13-20-22-19(24)25-15(4)10-14(3)23-25/h7-8,10-13H,5-6,9H2,1-4H3/b21-12- |
| InChIKey | TXRVINQXXZOWGH-MTJSOVHGSA-N |
| XLogP | 3.15 |
| TPSA | 79.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|