C15H16N6O — CID 4072667
N-[3-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-4-yl]-1-(4-methoxyphenyl)methanimine (PubChem CID 4072667) has the molecular formula C15H16N6O and a molecular weight of 296.33 g/mol. Its IUPAC name is N-[3-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-4-yl]-1-(4-methoxyphenyl)methanimine.
| Compound Name | N-[3-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-4-yl]-1-(4-methoxyphenyl)methanimine |
|---|---|
| PubChem CID | 4072667 |
| Molecular Formula | C15H16N6O |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | N-[3-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-4-yl]-1-(4-methoxyphenyl)methanimine |
| SMILES | COc1ccc(C=Nn2cnnc2-n2nc(C)cc2C)cc1 |
| InChI | InChI=1S/C15H16N6O/c1-11-8-12(2)21(19-11)15-18-16-10-20(15)17-9-13-4-6-14(22-3)7-5-13/h4-10H,1-3H3 |
| InChIKey | LWIWWTGAMVZHMC-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|