C14H13ClN6 — CID 5373853
(Z)-1-(2-chlorophenyl)-N-[3-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-4-yl]methanimine (PubChem CID 5373853) has the molecular formula C14H13ClN6 and a molecular weight of 300.75 g/mol. Its IUPAC name is (Z)-1-(2-chlorophenyl)-N-[3-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-4-yl]methanimine.
| Compound Name | (Z)-1-(2-chlorophenyl)-N-[3-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-4-yl]methanimine |
|---|---|
| PubChem CID | 5373853 |
| Molecular Formula | C14H13ClN6 |
| Molecular Weight | 300.75 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | (Z)-1-(2-chlorophenyl)-N-[3-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-4-yl]methanimine |
| SMILES | Cc1cc(C)n(-c2nncn2/N=C\c2ccccc2Cl)n1 |
| InChI | InChI=1S/C14H13ClN6/c1-10-7-11(2)21(19-10)14-18-16-9-20(14)17-8-12-5-3-4-6-13(12)15/h3-9H,1-2H3/b17-8- |
| InChIKey | UOHFHWFENLCTCJ-IUXPMGMMSA-N |
| XLogP | 2.62 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.75 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|