C16H17N7O4 — CID 3495052
1-(2,5-dimethoxy-4-nitrophenyl)-N-[3-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-4-yl]methanimine (PubChem CID 3495052) has the molecular formula C16H17N7O4 and a molecular weight of 371.36 g/mol. Its IUPAC name is 1-(2,5-dimethoxy-4-nitrophenyl)-N-[3-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-4-yl]methanimine.
| Compound Name | 1-(2,5-dimethoxy-4-nitrophenyl)-N-[3-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-4-yl]methanimine |
|---|---|
| PubChem CID | 3495052 |
| Molecular Formula | C16H17N7O4 |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.13 |
| IUPAC Name | 1-(2,5-dimethoxy-4-nitrophenyl)-N-[3-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-4-yl]methanimine |
| SMILES | COc1cc([N+](=O)[O-])c(OC)cc1C=Nn1cnnc1-n1nc(C)cc1C |
| InChI | InChI=1S/C16H17N7O4/c1-10-5-11(2)22(20-10)16-19-17-9-21(16)18-8-12-6-15(27-4)13(23(24)25)7-14(12)26-3/h5-9H,1-4H3 |
| InChIKey | HLISRQWEJMRYDT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 122.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|