C14H13N7O2 — CID 9244483
(Z)-N-[3-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-4-yl]-1-(4-nitrophenyl)methanimine (PubChem CID 9244483) has the molecular formula C14H13N7O2 and a molecular weight of 311.31 g/mol. Its IUPAC name is (Z)-N-[3-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-4-yl]-1-(4-nitrophenyl)methanimine.
| Compound Name | (Z)-N-[3-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-4-yl]-1-(4-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 9244483 |
| Molecular Formula | C14H13N7O2 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | (Z)-N-[3-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-4-yl]-1-(4-nitrophenyl)methanimine |
| SMILES | Cc1cc(C)n(-c2nncn2/N=C\c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C14H13N7O2/c1-10-7-11(2)20(18-10)14-17-15-9-19(14)16-8-12-3-5-13(6-4-12)21(22)23/h3-9H,1-2H3/b16-8- |
| InChIKey | SNISNTLTCHAWHH-PXNMLYILSA-N |
| XLogP | 1.87 |
| TPSA | 104.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|