C10H9N5O2S — CID 771840
N-(3-methylsulfanyl-1,2,4-triazol-4-yl)-1-(4-nitrophenyl)methanimine (PubChem CID 771840) has the molecular formula C10H9N5O2S and a molecular weight of 263.28 g/mol. Its IUPAC name is N-(3-methylsulfanyl-1,2,4-triazol-4-yl)-1-(4-nitrophenyl)methanimine.
| Compound Name | N-(3-methylsulfanyl-1,2,4-triazol-4-yl)-1-(4-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 771840 |
| Molecular Formula | C10H9N5O2S |
| Molecular Weight | 263.28 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | N-(3-methylsulfanyl-1,2,4-triazol-4-yl)-1-(4-nitrophenyl)methanimine |
| SMILES | CSc1nncn1N=Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H9N5O2S/c1-18-10-13-11-7-14(10)12-6-8-2-4-9(5-3-8)15(16)17/h2-7H,1H3 |
| InChIKey | MPJZHQCBGIHRMN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 86.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.28 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|