C20H17N7O6S — CID 51388907
methyl 1-[[4-[(Z)-[5-[(4-nitrophenoxy)methyl]furan-2-yl]methylideneamino]-1,2,4-triazol-3-yl]sulfanylmethyl]pyrazole-3-carboxylate (PubChem CID 51388907) has the molecular formula C20H17N7O6S and a molecular weight of 483.47 g/mol. Its IUPAC name is methyl 1-[[4-[(Z)-[5-[(4-nitrophenoxy)methyl]furan-2-yl]methylideneamino]-1,2,4-triazol-3-yl]sulfanylmethyl]pyrazole-3-carboxylate.
| Compound Name | methyl 1-[[4-[(Z)-[5-[(4-nitrophenoxy)methyl]furan-2-yl]methylideneamino]-1,2,4-triazol-3-yl]sulfanylmethyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 51388907 |
| Molecular Formula | C20H17N7O6S |
| Molecular Weight | 483.47 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | methyl 1-[[4-[(Z)-[5-[(4-nitrophenoxy)methyl]furan-2-yl]methylideneamino]-1,2,4-triazol-3-yl]sulfanylmethyl]pyrazole-3-carboxylate |
| SMILES | COC(=O)c1ccn(CSc2nncn2/N=C\c2ccc(COc3ccc([N+](=O)[O-])cc3)o2)n1 |
| InChI | InChI=1S/C20H17N7O6S/c1-31-19(28)18-8-9-25(24-18)13-34-20-23-21-12-26(20)22-10-16-6-7-17(33-16)11-32-15-4-2-14(3-5-15)27(29)30/h2-10,12H,11,13H2,1H3/b22-10- |
| InChIKey | YLIUWVAHIOALLO-YVNNLAQVSA-N |
| XLogP | 2.97 |
| TPSA | 152.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.47 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|