C16H15BrN4O2S — CID 29098104
(Z)-1-[5-[(4-bromophenoxy)methyl]furan-2-yl]-N-(3-ethylsulfanyl-1,2,4-triazol-4-yl)methanimine (PubChem CID 29098104) has the molecular formula C16H15BrN4O2S and a molecular weight of 407.29 g/mol. Its IUPAC name is (Z)-1-[5-[(4-bromophenoxy)methyl]furan-2-yl]-N-(3-ethylsulfanyl-1,2,4-triazol-4-yl)methanimine.
| Compound Name | (Z)-1-[5-[(4-bromophenoxy)methyl]furan-2-yl]-N-(3-ethylsulfanyl-1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 29098104 |
| Molecular Formula | C16H15BrN4O2S |
| Molecular Weight | 407.29 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | (Z)-1-[5-[(4-bromophenoxy)methyl]furan-2-yl]-N-(3-ethylsulfanyl-1,2,4-triazol-4-yl)methanimine |
| SMILES | CCSc1nncn1/N=C\c1ccc(COc2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C16H15BrN4O2S/c1-2-24-16-20-18-11-21(16)19-9-14-7-8-15(23-14)10-22-13-5-3-12(17)4-6-13/h3-9,11H,2,10H2,1H3/b19-9- |
| InChIKey | BGSSCCCHLPPTPP-OCKHKDLRSA-N |
| XLogP | 4.21 |
| TPSA | 65.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.29 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|