C17H13Cl5N4O4S — CID 91962015
acetic acid;N-(3-methylsulfanyl-1,2,4-triazol-4-yl)-1-[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]methanimine (PubChem CID 91962015) has the molecular formula C17H13Cl5N4O4S and a molecular weight of 546.65 g/mol. Its IUPAC name is acetic acid;N-(3-methylsulfanyl-1,2,4-triazol-4-yl)-1-[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]methanimine.
| Compound Name | acetic acid;N-(3-methylsulfanyl-1,2,4-triazol-4-yl)-1-[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]methanimine |
|---|---|
| PubChem CID | 91962015 |
| Molecular Formula | C17H13Cl5N4O4S |
| Molecular Weight | 546.65 g/mol |
| Exact Mass | 543.91 |
| IUPAC Name | acetic acid;N-(3-methylsulfanyl-1,2,4-triazol-4-yl)-1-[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-yl]methanimine |
| SMILES | CC(=O)O.CSc1nncn1N=Cc1ccc(COc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)o1 |
| InChI | InChI=1S/C15H9Cl5N4O2S.C2H4O2/c1-27-15-23-21-6-24(15)22-4-7-2-3-8(26-7)5-25-14-12(19)10(17)9(16)11(18)13(14)20;1-2(3)4/h2-4,6H,5H2,1H3;1H3,(H,3,4) |
| InChIKey | HDKVCZYOGDNODC-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 102.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.65 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|