C15H10F3N5O4S — CID 6221443
4-[(Z)-[5-[(4-nitrophenoxy)methyl]furan-2-yl]methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 6221443) has the molecular formula C15H10F3N5O4S and a molecular weight of 413.34 g/mol. Its IUPAC name is 4-[(Z)-[5-[(4-nitrophenoxy)methyl]furan-2-yl]methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-[5-[(4-nitrophenoxy)methyl]furan-2-yl]methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 6221443 |
| Molecular Formula | C15H10F3N5O4S |
| Molecular Weight | 413.34 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 4-[(Z)-[5-[(4-nitrophenoxy)methyl]furan-2-yl]methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | O=[N+]([O-])c1ccc(OCc2ccc(/C=N\n3c(C(F)(F)F)n[nH]c3=S)o2)cc1 |
| InChI | InChI=1S/C15H10F3N5O4S/c16-15(17,18)13-20-21-14(28)22(13)19-7-11-5-6-12(27-11)8-26-10-3-1-9(2-4-10)23(24)25/h1-7H,8H2,(H,21,28)/b19-7- |
| InChIKey | YTDACGOKEYPHFM-GXHLCREISA-N |
| XLogP | 3.92 |
| TPSA | 111.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.34 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|