C12H8F3N7O3S — CID 6211335
4-[(Z)-[5-[(4-nitropyrazol-1-yl)methyl]furan-2-yl]methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione (PubChem CID 6211335) has the molecular formula C12H8F3N7O3S and a molecular weight of 387.30 g/mol. Its IUPAC name is 4-[(Z)-[5-[(4-nitropyrazol-1-yl)methyl]furan-2-yl]methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-[5-[(4-nitropyrazol-1-yl)methyl]furan-2-yl]methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 6211335 |
| Molecular Formula | C12H8F3N7O3S |
| Molecular Weight | 387.30 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 4-[(Z)-[5-[(4-nitropyrazol-1-yl)methyl]furan-2-yl]methylideneamino]-3-(trifluoromethyl)-1H-1,2,4-triazole-5-thione |
| SMILES | O=[N+]([O-])c1cnn(Cc2ccc(/C=N\n3c(C(F)(F)F)n[nH]c3=S)o2)c1 |
| InChI | InChI=1S/C12H8F3N7O3S/c13-12(14,15)10-18-19-11(26)21(10)17-4-8-1-2-9(25-8)6-20-5-7(3-16-20)22(23)24/h1-5H,6H2,(H,19,26)/b17-4- |
| InChIKey | UFODHQCGUKZNLE-INGKJJEOSA-N |
| XLogP | 2.59 |
| TPSA | 120.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|