C12H11N7O3 — CID 9244516
(Z)-N-[3-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-4-yl]-1-(5-nitrofuran-2-yl)methanimine (PubChem CID 9244516) has the molecular formula C12H11N7O3 and a molecular weight of 301.27 g/mol. Its IUPAC name is (Z)-N-[3-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-4-yl]-1-(5-nitrofuran-2-yl)methanimine.
| Compound Name | (Z)-N-[3-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-4-yl]-1-(5-nitrofuran-2-yl)methanimine |
|---|---|
| PubChem CID | 9244516 |
| Molecular Formula | C12H11N7O3 |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | (Z)-N-[3-(3,5-dimethylpyrazol-1-yl)-1,2,4-triazol-4-yl]-1-(5-nitrofuran-2-yl)methanimine |
| SMILES | Cc1cc(C)n(-c2nncn2/N=C\c2ccc([N+](=O)[O-])o2)n1 |
| InChI | InChI=1S/C12H11N7O3/c1-8-5-9(2)18(16-8)12-15-13-7-17(12)14-6-10-3-4-11(22-10)19(20)21/h3-7H,1-2H3/b14-6- |
| InChIKey | VWQUWKCNAGXVMY-NSIKDUERSA-N |
| XLogP | 1.46 |
| TPSA | 117.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|