C16H17N7O3 — CID 5350246
(E)-N-[3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1,2,4-triazol-4-yl]-1-(4-methoxy-3-nitrophenyl)methanimine (PubChem CID 5350246) has the molecular formula C16H17N7O3 and a molecular weight of 355.36 g/mol. Its IUPAC name is (E)-N-[3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1,2,4-triazol-4-yl]-1-(4-methoxy-3-nitrophenyl)methanimine.
| Compound Name | (E)-N-[3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1,2,4-triazol-4-yl]-1-(4-methoxy-3-nitrophenyl)methanimine |
|---|---|
| PubChem CID | 5350246 |
| Molecular Formula | C16H17N7O3 |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | (E)-N-[3-(3,5-dimethylpyrazol-1-yl)-5-methyl-1,2,4-triazol-4-yl]-1-(4-methoxy-3-nitrophenyl)methanimine |
| SMILES | COc1ccc(/C=N/n2c(C)nnc2-n2nc(C)cc2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H17N7O3/c1-10-7-11(2)21(20-10)16-19-18-12(3)22(16)17-9-13-5-6-15(26-4)14(8-13)23(24)25/h5-9H,1-4H3/b17-9+ |
| InChIKey | DZHBAFGVPWLQBL-RQZCQDPDSA-N |
| XLogP | 2.19 |
| TPSA | 113.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|