C19H24N6O2S — CID 8872841
4-[(Z)-(3-butoxy-4-methoxyphenyl)methylideneamino]-3-(3,5-dimethylpyrazol-1-yl)-1H-1,2,4-triazole-5-thione (PubChem CID 8872841) has the molecular formula C19H24N6O2S and a molecular weight of 400.51 g/mol. Its IUPAC name is 4-[(Z)-(3-butoxy-4-methoxyphenyl)methylideneamino]-3-(3,5-dimethylpyrazol-1-yl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(3-butoxy-4-methoxyphenyl)methylideneamino]-3-(3,5-dimethylpyrazol-1-yl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 8872841 |
| Molecular Formula | C19H24N6O2S |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 4-[(Z)-(3-butoxy-4-methoxyphenyl)methylideneamino]-3-(3,5-dimethylpyrazol-1-yl)-1H-1,2,4-triazole-5-thione |
| SMILES | CCCCOc1cc(/C=N\n2c(-n3nc(C)cc3C)n[nH]c2=S)ccc1OC |
| InChI | InChI=1S/C19H24N6O2S/c1-5-6-9-27-17-11-15(7-8-16(17)26-4)12-20-25-18(21-22-19(25)28)24-14(3)10-13(2)23-24/h7-8,10-12H,5-6,9H2,1-4H3,(H,22,28)/b20-12- |
| InChIKey | MPWWCZIZHVBWBB-NDENLUEZSA-N |
| XLogP | 3.81 |
| TPSA | 82.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|