C21H24N4O2S — CID 110522232
(Z)-N-(3-benzyl-5-methylsulfanyl-1,2,4-triazol-4-yl)-1-(4-methoxy-3-propoxyphenyl)methanimine (PubChem CID 110522232) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is (Z)-N-(3-benzyl-5-methylsulfanyl-1,2,4-triazol-4-yl)-1-(4-methoxy-3-propoxyphenyl)methanimine.
| Compound Name | (Z)-N-(3-benzyl-5-methylsulfanyl-1,2,4-triazol-4-yl)-1-(4-methoxy-3-propoxyphenyl)methanimine |
|---|---|
| PubChem CID | 110522232 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | (Z)-N-(3-benzyl-5-methylsulfanyl-1,2,4-triazol-4-yl)-1-(4-methoxy-3-propoxyphenyl)methanimine |
| SMILES | CCCOc1cc(/C=N\n2c(Cc3ccccc3)nnc2SC)ccc1OC |
| InChI | InChI=1S/C21H24N4O2S/c1-4-12-27-19-13-17(10-11-18(19)26-2)15-22-25-20(23-24-21(25)28-3)14-16-8-6-5-7-9-16/h5-11,13,15H,4,12,14H2,1-3H3/b22-15- |
| InChIKey | BGOVVVHESCPNHW-JCMHNJIXSA-N |
| XLogP | 4.27 |
| TPSA | 61.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|