C19H19ClN4O2S — CID 136874228
4-[(Z)-(3-benzyl-5-methylsulfanyl-1,2,4-triazol-4-yl)iminomethyl]-2-chloro-6-ethoxyphenol (PubChem CID 136874228) has the molecular formula C19H19ClN4O2S and a molecular weight of 402.91 g/mol. Its IUPAC name is 4-[(Z)-(3-benzyl-5-methylsulfanyl-1,2,4-triazol-4-yl)iminomethyl]-2-chloro-6-ethoxyphenol.
| Compound Name | 4-[(Z)-(3-benzyl-5-methylsulfanyl-1,2,4-triazol-4-yl)iminomethyl]-2-chloro-6-ethoxyphenol |
|---|---|
| PubChem CID | 136874228 |
| Molecular Formula | C19H19ClN4O2S |
| Molecular Weight | 402.91 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 4-[(Z)-(3-benzyl-5-methylsulfanyl-1,2,4-triazol-4-yl)iminomethyl]-2-chloro-6-ethoxyphenol |
| SMILES | CCOc1cc(/C=N\n2c(Cc3ccccc3)nnc2SC)cc(Cl)c1O |
| InChI | InChI=1S/C19H19ClN4O2S/c1-3-26-16-10-14(9-15(20)18(16)25)12-21-24-17(22-23-19(24)27-2)11-13-7-5-4-6-8-13/h4-10,12,25H,3,11H2,1-2H3/b21-12- |
| InChIKey | OFYWHNXBLALOPT-MTJSOVHGSA-N |
| XLogP | 4.23 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.91 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|