C17H14Cl2N4O2S — CID 136874255
2,6-dichloro-4-[(Z)-[3-methylsulfanyl-5-(phenoxymethyl)-1,2,4-triazol-4-yl]iminomethyl]phenol (PubChem CID 136874255) has the molecular formula C17H14Cl2N4O2S and a molecular weight of 409.30 g/mol. Its IUPAC name is 2,6-dichloro-4-[(Z)-[3-methylsulfanyl-5-(phenoxymethyl)-1,2,4-triazol-4-yl]iminomethyl]phenol.
| Compound Name | 2,6-dichloro-4-[(Z)-[3-methylsulfanyl-5-(phenoxymethyl)-1,2,4-triazol-4-yl]iminomethyl]phenol |
|---|---|
| PubChem CID | 136874255 |
| Molecular Formula | C17H14Cl2N4O2S |
| Molecular Weight | 409.30 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | 2,6-dichloro-4-[(Z)-[3-methylsulfanyl-5-(phenoxymethyl)-1,2,4-triazol-4-yl]iminomethyl]phenol |
| SMILES | CSc1nnc(COc2ccccc2)n1/N=C\c1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C17H14Cl2N4O2S/c1-26-17-22-21-15(10-25-12-5-3-2-4-6-12)23(17)20-9-11-7-13(18)16(24)14(19)8-11/h2-9,24H,10H2,1H3/b20-9- |
| InChIKey | SJSFJIYPXBIHHS-UKWGHVSLSA-N |
| XLogP | 4.47 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.30 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|