C19H20N4O3S — CID 110522426
(Z)-1-(2,4-dimethoxyphenyl)-N-[3-methylsulfanyl-5-(phenoxymethyl)-1,2,4-triazol-4-yl]methanimine (PubChem CID 110522426) has the molecular formula C19H20N4O3S and a molecular weight of 384.46 g/mol. Its IUPAC name is (Z)-1-(2,4-dimethoxyphenyl)-N-[3-methylsulfanyl-5-(phenoxymethyl)-1,2,4-triazol-4-yl]methanimine.
| Compound Name | (Z)-1-(2,4-dimethoxyphenyl)-N-[3-methylsulfanyl-5-(phenoxymethyl)-1,2,4-triazol-4-yl]methanimine |
|---|---|
| PubChem CID | 110522426 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | (Z)-1-(2,4-dimethoxyphenyl)-N-[3-methylsulfanyl-5-(phenoxymethyl)-1,2,4-triazol-4-yl]methanimine |
| SMILES | COc1ccc(/C=N\n2c(COc3ccccc3)nnc2SC)c(OC)c1 |
| InChI | InChI=1S/C19H20N4O3S/c1-24-16-10-9-14(17(11-16)25-2)12-20-23-18(21-22-19(23)27-3)13-26-15-7-5-4-6-8-15/h4-12H,13H2,1-3H3/b20-12- |
| InChIKey | BVQWSJGLGNDUJC-NDENLUEZSA-N |
| XLogP | 3.48 |
| TPSA | 70.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|