C26H27N5OS — CID 110522287
N-benzyl-N-ethyl-4-[(Z)-[3-methylsulfanyl-5-(phenoxymethyl)-1,2,4-triazol-4-yl]iminomethyl]aniline (PubChem CID 110522287) has the molecular formula C26H27N5OS and a molecular weight of 457.60 g/mol. Its IUPAC name is N-benzyl-N-ethyl-4-[(Z)-[3-methylsulfanyl-5-(phenoxymethyl)-1,2,4-triazol-4-yl]iminomethyl]aniline.
| Compound Name | N-benzyl-N-ethyl-4-[(Z)-[3-methylsulfanyl-5-(phenoxymethyl)-1,2,4-triazol-4-yl]iminomethyl]aniline |
|---|---|
| PubChem CID | 110522287 |
| Molecular Formula | C26H27N5OS |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | N-benzyl-N-ethyl-4-[(Z)-[3-methylsulfanyl-5-(phenoxymethyl)-1,2,4-triazol-4-yl]iminomethyl]aniline |
| SMILES | CCN(Cc1ccccc1)c1ccc(/C=N\n2c(COc3ccccc3)nnc2SC)cc1 |
| InChI | InChI=1S/C26H27N5OS/c1-3-30(19-22-10-6-4-7-11-22)23-16-14-21(15-17-23)18-27-31-25(28-29-26(31)33-2)20-32-24-12-8-5-9-13-24/h4-18H,3,19-20H2,1-2H3/b27-18- |
| InChIKey | YKRUFVXVKORYAG-IMRQLAEWSA-N |
| XLogP | 5.49 |
| TPSA | 55.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|