C17H15N5O5S — CID 136874242
4-[(Z)-[3-methylsulfanyl-5-(phenoxymethyl)-1,2,4-triazol-4-yl]iminomethyl]-6-nitrobenzene-1,3-diol (PubChem CID 136874242) has the molecular formula C17H15N5O5S and a molecular weight of 401.40 g/mol. Its IUPAC name is 4-[(Z)-[3-methylsulfanyl-5-(phenoxymethyl)-1,2,4-triazol-4-yl]iminomethyl]-6-nitrobenzene-1,3-diol.
| Compound Name | 4-[(Z)-[3-methylsulfanyl-5-(phenoxymethyl)-1,2,4-triazol-4-yl]iminomethyl]-6-nitrobenzene-1,3-diol |
|---|---|
| PubChem CID | 136874242 |
| Molecular Formula | C17H15N5O5S |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | 4-[(Z)-[3-methylsulfanyl-5-(phenoxymethyl)-1,2,4-triazol-4-yl]iminomethyl]-6-nitrobenzene-1,3-diol |
| SMILES | CSc1nnc(COc2ccccc2)n1/N=C\c1cc([N+](=O)[O-])c(O)cc1O |
| InChI | InChI=1S/C17H15N5O5S/c1-28-17-20-19-16(10-27-12-5-3-2-4-6-12)21(17)18-9-11-7-13(22(25)26)15(24)8-14(11)23/h2-9,23-24H,10H2,1H3/b18-9- |
| InChIKey | BYCCLRFBFQNZMG-NVMNQCDNSA-N |
| XLogP | 2.78 |
| TPSA | 135.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|