C13H15N5O4S — CID 136874189
4-[(Z)-(3-methylsulfanyl-5-propan-2-yl-1,2,4-triazol-4-yl)iminomethyl]-6-nitrobenzene-1,3-diol (PubChem CID 136874189) has the molecular formula C13H15N5O4S and a molecular weight of 337.36 g/mol. Its IUPAC name is 4-[(Z)-(3-methylsulfanyl-5-propan-2-yl-1,2,4-triazol-4-yl)iminomethyl]-6-nitrobenzene-1,3-diol.
| Compound Name | 4-[(Z)-(3-methylsulfanyl-5-propan-2-yl-1,2,4-triazol-4-yl)iminomethyl]-6-nitrobenzene-1,3-diol |
|---|---|
| PubChem CID | 136874189 |
| Molecular Formula | C13H15N5O4S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 4-[(Z)-(3-methylsulfanyl-5-propan-2-yl-1,2,4-triazol-4-yl)iminomethyl]-6-nitrobenzene-1,3-diol |
| SMILES | CSc1nnc(C(C)C)n1/N=C\c1cc([N+](=O)[O-])c(O)cc1O |
| InChI | InChI=1S/C13H15N5O4S/c1-7(2)12-15-16-13(23-3)17(12)14-6-8-4-9(18(21)22)11(20)5-10(8)19/h4-7,19-20H,1-3H3/b14-6- |
| InChIKey | UYGOCKAWSDOKPS-NSIKDUERSA-N |
| XLogP | 2.33 |
| TPSA | 126.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|