C12H11N5O4S — CID 136786793
4-[(Z)-(4-hydroxy-3-nitrophenyl)methylideneamino]-6-methyl-3-methylsulfanyl-1,2,4-triazin-5-one (PubChem CID 136786793) has the molecular formula C12H11N5O4S and a molecular weight of 321.32 g/mol. Its IUPAC name is 4-[(Z)-(4-hydroxy-3-nitrophenyl)methylideneamino]-6-methyl-3-methylsulfanyl-1,2,4-triazin-5-one.
| Compound Name | 4-[(Z)-(4-hydroxy-3-nitrophenyl)methylideneamino]-6-methyl-3-methylsulfanyl-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136786793 |
| Molecular Formula | C12H11N5O4S |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 4-[(Z)-(4-hydroxy-3-nitrophenyl)methylideneamino]-6-methyl-3-methylsulfanyl-1,2,4-triazin-5-one |
| SMILES | CSc1nnc(C)c(=O)n1/N=C\c1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H11N5O4S/c1-7-11(19)16(12(22-2)15-14-7)13-6-8-3-4-10(18)9(5-8)17(20)21/h3-6,18H,1-2H3/b13-6- |
| InChIKey | PJOKRRFUXKLBMM-MLPAPPSSSA-N |
| XLogP | 1.16 |
| TPSA | 123.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|