C12H11BrN4O2S — CID 136786789
4-[(Z)-(3-bromo-4-hydroxyphenyl)methylideneamino]-6-methyl-3-methylsulfanyl-1,2,4-triazin-5-one (PubChem CID 136786789) has the molecular formula C12H11BrN4O2S and a molecular weight of 355.22 g/mol. Its IUPAC name is 4-[(Z)-(3-bromo-4-hydroxyphenyl)methylideneamino]-6-methyl-3-methylsulfanyl-1,2,4-triazin-5-one.
| Compound Name | 4-[(Z)-(3-bromo-4-hydroxyphenyl)methylideneamino]-6-methyl-3-methylsulfanyl-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 136786789 |
| Molecular Formula | C12H11BrN4O2S |
| Molecular Weight | 355.22 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 4-[(Z)-(3-bromo-4-hydroxyphenyl)methylideneamino]-6-methyl-3-methylsulfanyl-1,2,4-triazin-5-one |
| SMILES | CSc1nnc(C)c(=O)n1/N=C\c1ccc(O)c(Br)c1 |
| InChI | InChI=1S/C12H11BrN4O2S/c1-7-11(19)17(12(20-2)16-15-7)14-6-8-3-4-10(18)9(13)5-8/h3-6,18H,1-2H3/b14-6- |
| InChIKey | VGDSUAUKJPFPGA-NSIKDUERSA-N |
| XLogP | 2.02 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.22 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|