C15H18N4O4S — CID 23881510
6-methyl-3-methylsulfanyl-4-[(3,4,5-trimethoxyphenyl)methylideneamino]-1,2,4-triazin-5-one (PubChem CID 23881510) has the molecular formula C15H18N4O4S and a molecular weight of 350.40 g/mol. Its IUPAC name is 6-methyl-3-methylsulfanyl-4-[(3,4,5-trimethoxyphenyl)methylideneamino]-1,2,4-triazin-5-one.
| Compound Name | 6-methyl-3-methylsulfanyl-4-[(3,4,5-trimethoxyphenyl)methylideneamino]-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 23881510 |
| Molecular Formula | C15H18N4O4S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 6-methyl-3-methylsulfanyl-4-[(3,4,5-trimethoxyphenyl)methylideneamino]-1,2,4-triazin-5-one |
| SMILES | COc1cc(C=Nn2c(SC)nnc(C)c2=O)cc(OC)c1OC |
| InChI | InChI=1S/C15H18N4O4S/c1-9-14(20)19(15(24-5)18-17-9)16-8-10-6-11(21-2)13(23-4)12(7-10)22-3/h6-8H,1-5H3 |
| InChIKey | SGAVSJCZJIKFKW-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 87.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|