C12H15N5S — CID 110522095
(Z)-N-(3-methylsulfanyl-5-propan-2-yl-1,2,4-triazol-4-yl)-1-pyridin-2-ylmethanimine (PubChem CID 110522095) has the molecular formula C12H15N5S and a molecular weight of 261.35 g/mol. Its IUPAC name is (Z)-N-(3-methylsulfanyl-5-propan-2-yl-1,2,4-triazol-4-yl)-1-pyridin-2-ylmethanimine.
| Compound Name | (Z)-N-(3-methylsulfanyl-5-propan-2-yl-1,2,4-triazol-4-yl)-1-pyridin-2-ylmethanimine |
|---|---|
| PubChem CID | 110522095 |
| Molecular Formula | C12H15N5S |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | (Z)-N-(3-methylsulfanyl-5-propan-2-yl-1,2,4-triazol-4-yl)-1-pyridin-2-ylmethanimine |
| SMILES | CSc1nnc(C(C)C)n1/N=C\c1ccccn1 |
| InChI | InChI=1S/C12H15N5S/c1-9(2)11-15-16-12(18-3)17(11)14-8-10-6-4-5-7-13-10/h4-9H,1-3H3/b14-8- |
| InChIKey | OUAVCNLAHOWSBA-ZSOIEALJSA-N |
| XLogP | 2.40 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|