C17H24N4OS — CID 110521957
(Z)-1-(4-butoxyphenyl)-N-(3-methylsulfanyl-5-propan-2-yl-1,2,4-triazol-4-yl)methanimine (PubChem CID 110521957) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is (Z)-1-(4-butoxyphenyl)-N-(3-methylsulfanyl-5-propan-2-yl-1,2,4-triazol-4-yl)methanimine.
| Compound Name | (Z)-1-(4-butoxyphenyl)-N-(3-methylsulfanyl-5-propan-2-yl-1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 110521957 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | (Z)-1-(4-butoxyphenyl)-N-(3-methylsulfanyl-5-propan-2-yl-1,2,4-triazol-4-yl)methanimine |
| SMILES | CCCCOc1ccc(/C=N\n2c(SC)nnc2C(C)C)cc1 |
| InChI | InChI=1S/C17H24N4OS/c1-5-6-11-22-15-9-7-14(8-10-15)12-18-21-16(13(2)3)19-20-17(21)23-4/h7-10,12-13H,5-6,11H2,1-4H3/b18-12- |
| InChIKey | WMDJCROESUGLOY-PDGQHHTCSA-N |
| XLogP | 4.18 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|