C9H7N5O4S — CID 136920925
4-[(Z)-(2,4-dihydroxy-5-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 136920925) has the molecular formula C9H7N5O4S and a molecular weight of 281.25 g/mol. Its IUPAC name is 4-[(Z)-(2,4-dihydroxy-5-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(2,4-dihydroxy-5-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 136920925 |
| Molecular Formula | C9H7N5O4S |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | 4-[(Z)-(2,4-dihydroxy-5-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | O=[N+]([O-])c1cc(/C=N\n2cn[nH]c2=S)c(O)cc1O |
| InChI | InChI=1S/C9H7N5O4S/c15-7-2-8(16)6(14(17)18)1-5(7)3-11-13-4-10-12-9(13)19/h1-4,15-16H,(H,12,19)/b11-3- |
| InChIKey | GLCJSXLOLLVKLW-JYOAFUTRSA-N |
| XLogP | 1.14 |
| TPSA | 129.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|