C13H15N5O4S — CID 110519104
4-[(Z)-(2,4-diethoxy-5-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione (PubChem CID 110519104) has the molecular formula C13H15N5O4S and a molecular weight of 337.36 g/mol. Its IUPAC name is 4-[(Z)-(2,4-diethoxy-5-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[(Z)-(2,4-diethoxy-5-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 110519104 |
| Molecular Formula | C13H15N5O4S |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 4-[(Z)-(2,4-diethoxy-5-nitrophenyl)methylideneamino]-1H-1,2,4-triazole-5-thione |
| SMILES | CCOc1cc(OCC)c([N+](=O)[O-])cc1/C=N\n1cn[nH]c1=S |
| InChI | InChI=1S/C13H15N5O4S/c1-3-21-11-6-12(22-4-2)10(18(19)20)5-9(11)7-15-17-8-14-16-13(17)23/h5-8H,3-4H2,1-2H3,(H,16,23)/b15-7- |
| InChIKey | VFRLFXXBIZNKIA-CHHVJCJISA-N |
| XLogP | 2.53 |
| TPSA | 107.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|