C16H23N3O5 — CID 110506922
N-[(E)-(2,4-diethoxy-5-nitrophenyl)methylideneamino]pentanamide (PubChem CID 110506922) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is N-[(E)-(2,4-diethoxy-5-nitrophenyl)methylideneamino]pentanamide.
| Compound Name | N-[(E)-(2,4-diethoxy-5-nitrophenyl)methylideneamino]pentanamide |
|---|---|
| PubChem CID | 110506922 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | N-[(E)-(2,4-diethoxy-5-nitrophenyl)methylideneamino]pentanamide |
| SMILES | CCCCC(=O)N/N=C/c1cc([N+](=O)[O-])c(OCC)cc1OCC |
| InChI | InChI=1S/C16H23N3O5/c1-4-7-8-16(20)18-17-11-12-9-13(19(21)22)15(24-6-3)10-14(12)23-5-2/h9-11H,4-8H2,1-3H3,(H,18,20)/b17-11+ |
| InChIKey | VUMQYHQGVBTTPT-GZTJUZNOSA-N |
| XLogP | 3.03 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|