C14H10N4O6 — CID 135618948
4-nitro-6-[(E)-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]methyl]benzene-1,3-diol (PubChem CID 135618948) has the molecular formula C14H10N4O6 and a molecular weight of 330.26 g/mol. Its IUPAC name is 4-nitro-6-[(E)-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]methyl]benzene-1,3-diol.
| Compound Name | 4-nitro-6-[(E)-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]methyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135618948 |
| Molecular Formula | C14H10N4O6 |
| Molecular Weight | 330.26 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 4-nitro-6-[(E)-[(Z)-(4-nitrophenyl)methylidenehydrazinylidene]methyl]benzene-1,3-diol |
| SMILES | O=[N+]([O-])c1ccc(/C=N\N=C\c2cc([N+](=O)[O-])c(O)cc2O)cc1 |
| InChI | InChI=1S/C14H10N4O6/c19-13-6-14(20)12(18(23)24)5-10(13)8-16-15-7-9-1-3-11(4-2-9)17(21)22/h1-8,19-20H/b15-7-,16-8+ |
| InChIKey | LWGFNUOLGFNTTP-BSHIDLADSA-N |
| XLogP | 2.37 |
| TPSA | 151.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|