C17H13Cl2N5O4S — CID 135667318
4-[(E)-[3-[(2,4-dichlorophenyl)methylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]iminomethyl]-6-nitrobenzene-1,3-diol (PubChem CID 135667318) has the molecular formula C17H13Cl2N5O4S and a molecular weight of 454.30 g/mol. Its IUPAC name is 4-[(E)-[3-[(2,4-dichlorophenyl)methylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]iminomethyl]-6-nitrobenzene-1,3-diol.
| Compound Name | 4-[(E)-[3-[(2,4-dichlorophenyl)methylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]iminomethyl]-6-nitrobenzene-1,3-diol |
|---|---|
| PubChem CID | 135667318 |
| Molecular Formula | C17H13Cl2N5O4S |
| Molecular Weight | 454.30 g/mol |
| Exact Mass | 453.01 |
| IUPAC Name | 4-[(E)-[3-[(2,4-dichlorophenyl)methylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]iminomethyl]-6-nitrobenzene-1,3-diol |
| SMILES | Cc1nnc(SCc2ccc(Cl)cc2Cl)n1/N=C/c1cc([N+](=O)[O-])c(O)cc1O |
| InChI | InChI=1S/C17H13Cl2N5O4S/c1-9-21-22-17(29-8-10-2-3-12(18)5-13(10)19)23(9)20-7-11-4-14(24(27)28)16(26)6-15(11)25/h2-7,25-26H,8H2,1H3/b20-7+ |
| InChIKey | MOXRGBSBTDOOHC-IFRROFPPSA-N |
| XLogP | 4.39 |
| TPSA | 126.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.30 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|