C18H14Cl2N4O2S — CID 20998589
2-[(E)-[3-[(2,4-dichlorophenyl)methylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]iminomethyl]benzoic acid (PubChem CID 20998589) has the molecular formula C18H14Cl2N4O2S and a molecular weight of 421.31 g/mol. Its IUPAC name is 2-[(E)-[3-[(2,4-dichlorophenyl)methylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]iminomethyl]benzoic acid.
| Compound Name | 2-[(E)-[3-[(2,4-dichlorophenyl)methylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]iminomethyl]benzoic acid |
|---|---|
| PubChem CID | 20998589 |
| Molecular Formula | C18H14Cl2N4O2S |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | 2-[(E)-[3-[(2,4-dichlorophenyl)methylsulfanyl]-5-methyl-1,2,4-triazol-4-yl]iminomethyl]benzoic acid |
| SMILES | Cc1nnc(SCc2ccc(Cl)cc2Cl)n1/N=C/c1ccccc1C(=O)O |
| InChI | InChI=1S/C18H14Cl2N4O2S/c1-11-22-23-18(27-10-13-6-7-14(19)8-16(13)20)24(11)21-9-12-4-2-3-5-15(12)17(25)26/h2-9H,10H2,1H3,(H,25,26)/b21-9+ |
| InChIKey | RQRLGKRATRQFLU-ZVBGSRNCSA-N |
| XLogP | 4.77 |
| TPSA | 80.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|