C15H19BrN4OS — CID 110521803
(Z)-1-(3-bromo-4-propoxyphenyl)-N-(3-ethyl-5-methylsulfanyl-1,2,4-triazol-4-yl)methanimine (PubChem CID 110521803) has the molecular formula C15H19BrN4OS and a molecular weight of 383.32 g/mol. Its IUPAC name is (Z)-1-(3-bromo-4-propoxyphenyl)-N-(3-ethyl-5-methylsulfanyl-1,2,4-triazol-4-yl)methanimine.
| Compound Name | (Z)-1-(3-bromo-4-propoxyphenyl)-N-(3-ethyl-5-methylsulfanyl-1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 110521803 |
| Molecular Formula | C15H19BrN4OS |
| Molecular Weight | 383.32 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | (Z)-1-(3-bromo-4-propoxyphenyl)-N-(3-ethyl-5-methylsulfanyl-1,2,4-triazol-4-yl)methanimine |
| SMILES | CCCOc1ccc(/C=N\n2c(CC)nnc2SC)cc1Br |
| InChI | InChI=1S/C15H19BrN4OS/c1-4-8-21-13-7-6-11(9-12(13)16)10-17-20-14(5-2)18-19-15(20)22-3/h6-7,9-10H,4-5,8H2,1-3H3/b17-10- |
| InChIKey | XOYZZAPQXJTXPH-YVLHZVERSA-N |
| XLogP | 4.00 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|