C14H16Br2N4OS — CID 110521800
(Z)-1-(3,5-dibromo-4-ethoxyphenyl)-N-(3-ethyl-5-methylsulfanyl-1,2,4-triazol-4-yl)methanimine (PubChem CID 110521800) has the molecular formula C14H16Br2N4OS and a molecular weight of 448.18 g/mol. Its IUPAC name is (Z)-1-(3,5-dibromo-4-ethoxyphenyl)-N-(3-ethyl-5-methylsulfanyl-1,2,4-triazol-4-yl)methanimine.
| Compound Name | (Z)-1-(3,5-dibromo-4-ethoxyphenyl)-N-(3-ethyl-5-methylsulfanyl-1,2,4-triazol-4-yl)methanimine |
|---|---|
| PubChem CID | 110521800 |
| Molecular Formula | C14H16Br2N4OS |
| Molecular Weight | 448.18 g/mol |
| Exact Mass | 445.94 |
| IUPAC Name | (Z)-1-(3,5-dibromo-4-ethoxyphenyl)-N-(3-ethyl-5-methylsulfanyl-1,2,4-triazol-4-yl)methanimine |
| SMILES | CCOc1c(Br)cc(/C=N\n2c(CC)nnc2SC)cc1Br |
| InChI | InChI=1S/C14H16Br2N4OS/c1-4-12-18-19-14(22-3)20(12)17-8-9-6-10(15)13(21-5-2)11(16)7-9/h6-8H,4-5H2,1-3H3/b17-8- |
| InChIKey | YLKGJVXEPCYXNK-IUXPMGMMSA-N |
| XLogP | 4.37 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.18 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|