C12H12Br2N4O2S — CID 136874160
2,4-dibromo-6-[(Z)-(3-ethyl-5-methylsulfanyl-1,2,4-triazol-4-yl)iminomethyl]benzene-1,3-diol (PubChem CID 136874160) has the molecular formula C12H12Br2N4O2S and a molecular weight of 436.13 g/mol. Its IUPAC name is 2,4-dibromo-6-[(Z)-(3-ethyl-5-methylsulfanyl-1,2,4-triazol-4-yl)iminomethyl]benzene-1,3-diol.
| Compound Name | 2,4-dibromo-6-[(Z)-(3-ethyl-5-methylsulfanyl-1,2,4-triazol-4-yl)iminomethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 136874160 |
| Molecular Formula | C12H12Br2N4O2S |
| Molecular Weight | 436.13 g/mol |
| Exact Mass | 433.90 |
| IUPAC Name | 2,4-dibromo-6-[(Z)-(3-ethyl-5-methylsulfanyl-1,2,4-triazol-4-yl)iminomethyl]benzene-1,3-diol |
| SMILES | CCc1nnc(SC)n1/N=C\c1cc(Br)c(O)c(Br)c1O |
| InChI | InChI=1S/C12H12Br2N4O2S/c1-3-8-16-17-12(21-2)18(8)15-5-6-4-7(13)11(20)9(14)10(6)19/h4-5,19-20H,3H2,1-2H3/b15-5- |
| InChIKey | VPODJCLGWYVPCB-WCSRMQSCSA-N |
| XLogP | 3.38 |
| TPSA | 83.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.13 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|