C11H12Br2N6O2 — CID 4682377
4-[[(4-amino-5-ethyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-2,6-dibromobenzene-1,3-diol (PubChem CID 4682377) has the molecular formula C11H12Br2N6O2 and a molecular weight of 420.07 g/mol. Its IUPAC name is 4-[[(4-amino-5-ethyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-2,6-dibromobenzene-1,3-diol.
| Compound Name | 4-[[(4-amino-5-ethyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-2,6-dibromobenzene-1,3-diol |
|---|---|
| PubChem CID | 4682377 |
| Molecular Formula | C11H12Br2N6O2 |
| Molecular Weight | 420.07 g/mol |
| Exact Mass | 417.94 |
| IUPAC Name | 4-[[(4-amino-5-ethyl-1,2,4-triazol-3-yl)hydrazinylidene]methyl]-2,6-dibromobenzene-1,3-diol |
| SMILES | CCc1nnc(NN=Cc2cc(Br)c(O)c(Br)c2O)n1N |
| InChI | InChI=1S/C11H12Br2N6O2/c1-2-7-16-18-11(19(7)14)17-15-4-5-3-6(12)10(21)8(13)9(5)20/h3-4,20-21H,2,14H2,1H3,(H,17,18) |
| InChIKey | YCAIQAWGQPHNLS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 121.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.07 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|