C12H14Br2N2O3 — CID 136712213
N-[(E)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]pentanamide (PubChem CID 136712213) has the molecular formula C12H14Br2N2O3 and a molecular weight of 394.06 g/mol. Its IUPAC name is N-[(E)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]pentanamide.
| Compound Name | N-[(E)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]pentanamide |
|---|---|
| PubChem CID | 136712213 |
| Molecular Formula | C12H14Br2N2O3 |
| Molecular Weight | 394.06 g/mol |
| Exact Mass | 391.94 |
| IUPAC Name | N-[(E)-(3,5-dibromo-2,4-dihydroxyphenyl)methylideneamino]pentanamide |
| SMILES | CCCCC(=O)N/N=C/c1cc(Br)c(O)c(Br)c1O |
| InChI | InChI=1S/C12H14Br2N2O3/c1-2-3-4-9(17)16-15-6-7-5-8(13)12(19)10(14)11(7)18/h5-6,18-19H,2-4H2,1H3,(H,16,17)/b15-6+ |
| InChIKey | ZUEJFJMGQZZRLL-GIDUJCDVSA-N |
| XLogP | 3.26 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.06 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|