C22H33BrN4O3 — CID 135684113
N-[[5-bromo-3-[(E)-(heptanoylhydrazinylidene)methyl]-2-hydroxyphenyl]methylideneamino]heptanamide (PubChem CID 135684113) has the molecular formula C22H33BrN4O3 and a molecular weight of 481.44 g/mol. Its IUPAC name is N-[[5-bromo-3-[(E)-(heptanoylhydrazinylidene)methyl]-2-hydroxyphenyl]methylideneamino]heptanamide.
| Compound Name | N-[[5-bromo-3-[(E)-(heptanoylhydrazinylidene)methyl]-2-hydroxyphenyl]methylideneamino]heptanamide |
|---|---|
| PubChem CID | 135684113 |
| Molecular Formula | C22H33BrN4O3 |
| Molecular Weight | 481.44 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | N-[[5-bromo-3-[(E)-(heptanoylhydrazinylidene)methyl]-2-hydroxyphenyl]methylideneamino]heptanamide |
| SMILES | CCCCCCC(=O)NN=Cc1cc(Br)cc(/C=N/NC(=O)CCCCCC)c1O |
| InChI | InChI=1S/C22H33BrN4O3/c1-3-5-7-9-11-20(28)26-24-15-17-13-19(23)14-18(22(17)30)16-25-27-21(29)12-10-8-6-4-2/h13-16,30H,3-12H2,1-2H3,(H,26,28)(H,27,29)/b24-15+,25-16? |
| InChIKey | LVZHQHRAVKGAML-ANZABGTBSA-N |
| XLogP | 5.00 |
| TPSA | 103.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|