C13H17N3O3 — CID 175194656
N-[(2-hydroxy-5-nitrosophenyl)methylideneamino]hexanamide (PubChem CID 175194656) has the molecular formula C13H17N3O3 and a molecular weight of 263.30 g/mol. Its IUPAC name is N-[(2-hydroxy-5-nitrosophenyl)methylideneamino]hexanamide.
| Compound Name | N-[(2-hydroxy-5-nitrosophenyl)methylideneamino]hexanamide |
|---|---|
| PubChem CID | 175194656 |
| Molecular Formula | C13H17N3O3 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | N-[(2-hydroxy-5-nitrosophenyl)methylideneamino]hexanamide |
| SMILES | CCCCCC(=O)NN=Cc1cc(N=O)ccc1O |
| InChI | InChI=1S/C13H17N3O3/c1-2-3-4-5-13(18)15-14-9-10-8-11(16-19)6-7-12(10)17/h6-9,17H,2-5H2,1H3,(H,15,18) |
| InChIKey | BHXUPMIIVVVHDQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|