C13H18N2O3 — CID 2317832
N-[(3,4-dihydroxyphenyl)methylideneamino]hexanamide (PubChem CID 2317832) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is N-[(3,4-dihydroxyphenyl)methylideneamino]hexanamide.
| Compound Name | N-[(3,4-dihydroxyphenyl)methylideneamino]hexanamide |
|---|---|
| PubChem CID | 2317832 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | N-[(3,4-dihydroxyphenyl)methylideneamino]hexanamide |
| SMILES | CCCCCC(=O)NN=Cc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H18N2O3/c1-2-3-4-5-13(18)15-14-9-10-6-7-11(16)12(17)8-10/h6-9,16-17H,2-5H2,1H3,(H,15,18) |
| InChIKey | HMDQCYQAYHOZPQ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|