C9H10N2O4 — CID 135435759
N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-2-hydroxyacetamide (PubChem CID 135435759) has the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. Its IUPAC name is N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-2-hydroxyacetamide.
| Compound Name | N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-2-hydroxyacetamide |
|---|---|
| PubChem CID | 135435759 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-2-hydroxyacetamide |
| SMILES | O=C(CO)N/N=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H10N2O4/c12-5-9(15)11-10-4-6-1-2-7(13)8(14)3-6/h1-4,12-14H,5H2,(H,11,15)/b10-4+ |
| InChIKey | YRGNNRUZRCBPLM-ONNFQVAWSA-N |
| XLogP | -0.46 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|